C27H35FN6O4 — CID 172677805
methyl (2S)-2-[[6-[4-(diaminomethylideneamino)butoxy]-1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoate (PubChem CID 172677805) has the molecular formula C27H35FN6O4 and a molecular weight of 526.61 g/mol. Its IUPAC name is methyl (2S)-2-[[6-[4-(diaminomethylideneamino)butoxy]-1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoate.
| Compound Name | methyl (2S)-2-[[6-[4-(diaminomethylideneamino)butoxy]-1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 172677805 |
| Molecular Formula | C27H35FN6O4 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | methyl (2S)-2-[[6-[4-(diaminomethylideneamino)butoxy]-1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1nn(Cc2ccc(F)cc2)c2cc(OCCCCN=C(N)N)ccc12)C(C)(C)C |
| InChI | InChI=1S/C27H35FN6O4/c1-27(2,3)23(25(36)37-4)32-24(35)22-20-12-11-19(38-14-6-5-13-31-26(29)30)15-21(20)34(33-22)16-17-7-9-18(28)10-8-17/h7-12,15,23H,5-6,13-14,16H2,1-4H3,(H,32,35)(H4,29,30,31)/t23-/m1/s1 |
| InChIKey | WMOAPWVQPPIAFY-HSZRJFAPSA-N |
| XLogP | 2.97 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|