About (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol
(R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol (PubChem CID 172677841) has the molecular formula C17H16N5OS+
and a molecular weight of 338.42 g/mol. Its IUPAC name is (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol.
Molecular Properties
| Compound Name | (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol |
| PubChem CID | 172677841 |
| Molecular Formula | C17H16N5OS+ |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol |
| SMILES | O[C@@H](c1cn(-c2ccccc2)nn1)c1c(C2CC2)sc2c[nH]c[n+]12 |
| InChI | InChI=1S/C17H15N5OS/c23-16(13-9-22(20-19-13)12-4-2-1-3-5-12)15-17(11-6-7-11)24-14-8-18-10-21(14)15/h1-5,8-11,16,23H,6-7H2/p+1/t16-/m0/s1 |
| InChIKey | UKUAOOUOSBGLGI-INIZCTEOSA-O |
| XLogP | 2.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol?
The IUPAC name of (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol (CID 172677841) is (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol.
What is the SMILES notation for (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol?
The canonical SMILES for (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol is O[C@@H](c1cn(-c2ccccc2)nn1)c1c(C2CC2)sc2c[nH]c[n+]12.
What is the InChIKey of (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol?
The InChIKey is UKUAOOUOSBGLGI-INIZCTEOSA-O. The full InChI is InChI=1S/C17H15N5OS/c23-16(13-9-22(20-19-13)12-4-2-1-3-5-12)15-17(11-6-7-11)24-14-8-18-10-21(14)15/h1-5,8-11,16,23H,6-7H2/p+1/t16-/m0/s1.
What are the key properties of (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol?
(R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol has a molecular weight of 338.42 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-(2-cyclopropyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-3-yl)-(1-phenyltriazol-4-yl)methanol is sourced from PubChem (CID 172677841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).