C6H3N5O — CID 172677895
6-oxa-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaene (PubChem CID 172677895) has the molecular formula C6H3N5O and a molecular weight of 161.12 g/mol. Its IUPAC name is 6-oxa-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaene.
| Compound Name | 6-oxa-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 172677895 |
| Molecular Formula | C6H3N5O |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 6-oxa-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaene |
| SMILES | c1nc2cn3cnnc3nc2o1 |
| InChI | InChI=1S/C6H3N5O/c1-4-5(12-3-7-4)9-6-10-8-2-11(1)6/h1-3H |
| InChIKey | IUGCXDXBVNOTGR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |