C17H32O3 — CID 172677950
1-(1,3-dioxol-4-yl)tetradecan-2-ol (PubChem CID 172677950) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-(1,3-dioxol-4-yl)tetradecan-2-ol.
| Compound Name | 1-(1,3-dioxol-4-yl)tetradecan-2-ol |
|---|---|
| PubChem CID | 172677950 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1-(1,3-dioxol-4-yl)tetradecan-2-ol |
| SMILES | CCCCCCCCCCCCC(O)CC1=COCO1 |
| InChI | InChI=1S/C17H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-16(18)13-17-14-19-15-20-17/h14,16,18H,2-13,15H2,1H3 |
| InChIKey | GVQKYFSXYXWJBU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|