C21H18BrN3O4 — CID 172678018
2-(5-bromo-2,3-dioxoindol-1-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 172678018) has the molecular formula C21H18BrN3O4 and a molecular weight of 456.30 g/mol. Its IUPAC name is 2-(5-bromo-2,3-dioxoindol-1-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(5-bromo-2,3-dioxoindol-1-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 172678018 |
| Molecular Formula | C21H18BrN3O4 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-(5-bromo-2,3-dioxoindol-1-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CN3C(=O)C(=O)c4cc(Br)ccc43)c2c1 |
| InChI | InChI=1S/C21H18BrN3O4/c1-29-14-3-4-17-15(9-14)12(10-24-17)6-7-23-19(26)11-25-18-5-2-13(22)8-16(18)20(27)21(25)28/h2-5,8-10,24H,6-7,11H2,1H3,(H,23,26) |
| InChIKey | MXWZUZUNZQBIJG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|