C11H23NNaO4S — CID 172678269
CID 172678269 (PubChem CID 172678269) has the molecular formula C11H23NNaO4S and a molecular weight of 288.36 g/mol.
| Compound Name | CID 172678269 |
|---|---|
| PubChem CID | 172678269 |
| Molecular Formula | C11H23NNaO4S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | — |
| SMILES | CCCCCCCC(=O)N(C)CCS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C11H23NO4S.Na/c1-3-4-5-6-7-8-11(13)12(2)9-10-17(14,15)16;/h3-10H2,1-2H3,(H,14,15,16); |
| InChIKey | AAQKCDIUEIKKTL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|