About ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane
ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane (PubChem CID 172679192) has the molecular formula C17H34O4Si
and a molecular weight of 330.54 g/mol. Its IUPAC name is ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane.
Molecular Properties
| Compound Name | ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane |
| PubChem CID | 172679192 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane |
| SMILES | C=CC(O[Si](C)(C)C=C)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-11-16(21-22(9,10)12-2)17(18-13(3)4,19-14(5)6)20-15(7)8/h11-16H,1-2H2,3-10H3 |
| InChIKey | ADVUYABSLJZJRY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane?
The IUPAC name of ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane (CID 172679192) is ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane.
What is the SMILES notation for ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane?
The canonical SMILES for ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane is C=CC(O[Si](C)(C)C=C)C(OC(C)C)(OC(C)C)OC(C)C.
What is the InChIKey of ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane?
The InChIKey is ADVUYABSLJZJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O4Si/c1-11-16(21-22(9,10)12-2)17(18-13(3)4,19-14(5)6)20-15(7)8/h11-16H,1-2H2,3-10H3.
What are the key properties of ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane?
ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane has a molecular weight of 330.54 g/mol, XLogP of 4.42, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-dimethyl-[1,1,1-tri(propan-2-yloxy)but-3-en-2-yloxy]silane is sourced from PubChem (CID 172679192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).