About 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid
3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid (PubChem CID 172679429) has the molecular formula C17H26ClF2NO2
and a molecular weight of 349.85 g/mol. Its IUPAC name is 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid |
| PubChem CID | 172679429 |
| Molecular Formula | C17H26ClF2NO2 |
| Molecular Weight | 349.85 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid |
| SMILES | CCCCCCCCCC(F)(F)CCn1ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C17H26ClF2NO2/c1-2-3-4-5-6-7-8-10-17(19,20)11-13-21-12-9-14(18)15(21)16(22)23/h9,12H,2-8,10-11,13H2,1H3,(H,22,23) |
| InChIKey | AESSRMDUYKFBMA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.85 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid?
The IUPAC name of 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid (CID 172679429) is 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid.
What is the SMILES notation for 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid?
The canonical SMILES for 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid is CCCCCCCCCC(F)(F)CCn1ccc(Cl)c1C(=O)O.
What is the InChIKey of 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid?
The InChIKey is AESSRMDUYKFBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClF2NO2/c1-2-3-4-5-6-7-8-10-17(19,20)11-13-21-12-9-14(18)15(21)16(22)23/h9,12H,2-8,10-11,13H2,1H3,(H,22,23).
What are the key properties of 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid?
3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid has a molecular weight of 349.85 g/mol, XLogP of 6.01, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(3,3-difluorododecyl)pyrrole-2-carboxylic acid is sourced from PubChem (CID 172679429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).