About CID 172680000
CID 172680000 (PubChem CID 172680000) has the molecular formula C10H14BrMg2NO
and a molecular weight of 292.74 g/mol.
Molecular Properties
| Compound Name | CID 172680000 |
| PubChem CID | 172680000 |
| Molecular Formula | C10H14BrMg2NO |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | — |
| SMILES | CN(C)CCOc1cc[c-]cc1.[Br-].[Mg+2].[Mg] |
| InChI | InChI=1S/C10H14NO.BrH.2Mg/c1-11(2)8-9-12-10-6-4-3-5-7-10;;;/h4-7H,8-9H2,1-2H3;1H;;/q-1;;;+2/p-1 |
| InChIKey | WVPVTYQQIWZKDQ-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 172680000 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172680000?
The IUPAC name of CID 172680000 (CID 172680000) is not available.
What is the SMILES notation for CID 172680000?
The canonical SMILES for CID 172680000 is CN(C)CCOc1cc[c-]cc1.[Br-].[Mg+2].[Mg].
What is the InChIKey of CID 172680000?
The InChIKey is WVPVTYQQIWZKDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14NO.BrH.2Mg/c1-11(2)8-9-12-10-6-4-3-5-7-10;;;/h4-7H,8-9H2,1-2H3;1H;;/q-1;;;+2/p-1.
What are the key properties of CID 172680000?
CID 172680000 has a molecular weight of 292.74 g/mol, XLogP of -2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172680000 is sourced from PubChem (CID 172680000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).