C23H40N4O10 — CID 172680677
N-[2-[2-[2-[2-[[(2R,3R,4R,5R)-5-[(2,6-dimethoxypyrimidin-4-yl)amino]-3,4-dihydroxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 172680677) has the molecular formula C23H40N4O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[[(2R,3R,4R,5R)-5-[(2,6-dimethoxypyrimidin-4-yl)amino]-3,4-dihydroxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[[(2R,3R,4R,5R)-5-[(2,6-dimethoxypyrimidin-4-yl)amino]-3,4-dihydroxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 172680677 |
| Molecular Formula | C23H40N4O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | N-[2-[2-[2-[2-[[(2R,3R,4R,5R)-5-[(2,6-dimethoxypyrimidin-4-yl)amino]-3,4-dihydroxyoxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCCOCCOC[C@H]1OC[C@@H](Nc2cc(OC)nc(OC)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H40N4O10/c1-4-19(28)24-5-6-33-7-8-34-9-10-35-11-12-36-15-17-22(30)21(29)16(14-37-17)25-18-13-20(31-2)27-23(26-18)32-3/h13,16-17,21-22,29-30H,4-12,14-15H2,1-3H3,(H,24,28)(H,25,26,27)/t16-,17-,21-,22+/m1/s1 |
| InChIKey | AIUUMPBFJROFBL-ZYOFANERSA-N |
| XLogP | -1.01 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|