C23H32ClN3O — CID 172681001
3-methoxy-2-[(5-nonylpyrrol-2-ylidene)methyl]-5-(1H-pyrrol-2-yl)-1H-pyrrole;hydrochloride (PubChem CID 172681001) has the molecular formula C23H32ClN3O and a molecular weight of 401.98 g/mol. Its IUPAC name is 3-methoxy-2-[(5-nonylpyrrol-2-ylidene)methyl]-5-(1H-pyrrol-2-yl)-1H-pyrrole;hydrochloride.
| Compound Name | 3-methoxy-2-[(5-nonylpyrrol-2-ylidene)methyl]-5-(1H-pyrrol-2-yl)-1H-pyrrole;hydrochloride |
|---|---|
| PubChem CID | 172681001 |
| Molecular Formula | C23H32ClN3O |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-methoxy-2-[(5-nonylpyrrol-2-ylidene)methyl]-5-(1H-pyrrol-2-yl)-1H-pyrrole;hydrochloride |
| SMILES | CCCCCCCCCC1=NC(=Cc2[nH]c(-c3ccc[nH]3)cc2OC)C=C1.Cl |
| InChI | InChI=1S/C23H31N3O.ClH/c1-3-4-5-6-7-8-9-11-18-13-14-19(25-18)16-22-23(27-2)17-21(26-22)20-12-10-15-24-20;/h10,12-17,24,26H,3-9,11H2,1-2H3;1H |
| InChIKey | AJXWZIUFBKTJDX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|