About 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one
5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one (PubChem CID 172681034) has the molecular formula C14H9BrF5NO2
and a molecular weight of 398.13 g/mol. Its IUPAC name is 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one |
| PubChem CID | 172681034 |
| Molecular Formula | C14H9BrF5NO2 |
| Molecular Weight | 398.13 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one |
| SMILES | Cn1cc(Oc2c(C(F)F)cc(F)cc2C(F)F)c(Br)cc1=O |
| InChI | InChI=1S/C14H9BrF5NO2/c1-21-5-10(9(15)4-11(21)22)23-12-7(13(17)18)2-6(16)3-8(12)14(19)20/h2-5,13-14H,1H3 |
| InChIKey | AKAZDGNMFGTMFE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.13 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one?
The IUPAC name of 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one (CID 172681034) is 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one.
What is the SMILES notation for 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one?
The canonical SMILES for 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one is Cn1cc(Oc2c(C(F)F)cc(F)cc2C(F)F)c(Br)cc1=O.
What is the InChIKey of 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one?
The InChIKey is AKAZDGNMFGTMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrF5NO2/c1-21-5-10(9(15)4-11(21)22)23-12-7(13(17)18)2-6(16)3-8(12)14(19)20/h2-5,13-14H,1H3.
What are the key properties of 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one?
5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one has a molecular weight of 398.13 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,6-bis(difluoromethyl)-4-fluorophenoxy]-4-bromo-1-methylpyridin-2-one is sourced from PubChem (CID 172681034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).