C18H43N3O2 — CID 172681094
azane;3-(1,1-dimethoxyethyl)-3-octylhexane-1,6-diamine (PubChem CID 172681094) has the molecular formula C18H43N3O2 and a molecular weight of 333.56 g/mol. Its IUPAC name is azane;3-(1,1-dimethoxyethyl)-3-octylhexane-1,6-diamine.
| Compound Name | azane;3-(1,1-dimethoxyethyl)-3-octylhexane-1,6-diamine |
|---|---|
| PubChem CID | 172681094 |
| Molecular Formula | C18H43N3O2 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.34 |
| IUPAC Name | azane;3-(1,1-dimethoxyethyl)-3-octylhexane-1,6-diamine |
| SMILES | CCCCCCCCC(CCN)(CCCN)C(C)(OC)OC.N |
| InChI | InChI=1S/C18H40N2O2.H3N/c1-5-6-7-8-9-10-12-18(14-16-20,13-11-15-19)17(2,21-3)22-4;/h5-16,19-20H2,1-4H3;1H3 |
| InChIKey | COUYYGSZOYSCBK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|