About 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole
2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole (PubChem CID 172682989) has the molecular formula C14H9BrN4S
and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole |
| PubChem CID | 172682989 |
| Molecular Formula | C14H9BrN4S |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole |
| SMILES | Brc1nc2c(Cn3cnc4cccnc43)cccc2s1 |
| InChI | InChI=1S/C14H9BrN4S/c15-14-18-12-9(3-1-5-11(12)20-14)7-19-8-17-10-4-2-6-16-13(10)19/h1-6,8H,7H2 |
| InChIKey | AQSOEYDIINEKAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole?
The IUPAC name of 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole (CID 172682989) is 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole.
What is the SMILES notation for 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole?
The canonical SMILES for 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole is Brc1nc2c(Cn3cnc4cccnc43)cccc2s1.
What is the InChIKey of 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole?
The InChIKey is AQSOEYDIINEKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrN4S/c15-14-18-12-9(3-1-5-11(12)20-14)7-19-8-17-10-4-2-6-16-13(10)19/h1-6,8H,7H2.
What are the key properties of 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole?
2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole has a molecular weight of 345.23 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(imidazo[4,5-b]pyridin-3-ylmethyl)-1,3-benzothiazole is sourced from PubChem (CID 172682989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).