C28H39N3O5 — CID 172684501
N'-[(2-cyclopentyl-6-methoxy-4-pyridinyl)methoxy]-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-ethyl-5-methylbenzenecarboximidamide (PubChem CID 172684501) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is N'-[(2-cyclopentyl-6-methoxy-4-pyridinyl)methoxy]-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-ethyl-5-methylbenzenecarboximidamide.
| Compound Name | N'-[(2-cyclopentyl-6-methoxy-4-pyridinyl)methoxy]-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-ethyl-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 172684501 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | N'-[(2-cyclopentyl-6-methoxy-4-pyridinyl)methoxy]-4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-3-ethyl-5-methylbenzenecarboximidamide |
| SMILES | CCc1cc(C(N)=NOCc2cc(OC)nc(C3CCCC3)c2)cc(C)c1OC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H39N3O5/c1-6-20-14-22(11-18(2)26(20)33-16-23-17-34-28(3,4)36-23)27(29)31-35-15-19-12-24(21-9-7-8-10-21)30-25(13-19)32-5/h11-14,21,23H,6-10,15-17H2,1-5H3,(H2,29,31)/t23-/m1/s1 |
| InChIKey | AVUOLRADINIXIQ-HSZRJFAPSA-N |
| XLogP | 4.99 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|