C19H16N6O3 — CID 172684519
N'-[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]benzohydrazide (PubChem CID 172684519) has the molecular formula C19H16N6O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is N'-[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]benzohydrazide.
| Compound Name | N'-[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 172684519 |
| Molecular Formula | C19H16N6O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N'-[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]benzohydrazide |
| SMILES | Cc1cnc(NNC(=O)c2ccccc2)nc1Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H16N6O3/c1-11-10-20-18(25-24-17(26)12-5-3-2-4-6-12)23-16(11)21-13-7-8-15-14(9-13)22-19(27)28-15/h2-10H,1H3,(H,22,27)(H,24,26)(H2,20,21,23,25) |
| InChIKey | AVVQSHNUDQNSSS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|