C22H18FN5O3 — CID 172684563
3-[5-[5-(5,5-dimethyl-4-oxo-1,2-oxazol-3-yl)-2-methylphenyl]pyrazin-2-yl]-2-fluoropyridine-4-carboxamide (PubChem CID 172684563) has the molecular formula C22H18FN5O3 and a molecular weight of 419.42 g/mol. Its IUPAC name is 3-[5-[5-(5,5-dimethyl-4-oxo-1,2-oxazol-3-yl)-2-methylphenyl]pyrazin-2-yl]-2-fluoropyridine-4-carboxamide.
| Compound Name | 3-[5-[5-(5,5-dimethyl-4-oxo-1,2-oxazol-3-yl)-2-methylphenyl]pyrazin-2-yl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 172684563 |
| Molecular Formula | C22H18FN5O3 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[5-[5-(5,5-dimethyl-4-oxo-1,2-oxazol-3-yl)-2-methylphenyl]pyrazin-2-yl]-2-fluoropyridine-4-carboxamide |
| SMILES | Cc1ccc(C2=NOC(C)(C)C2=O)cc1-c1cnc(-c2c(C(N)=O)ccnc2F)cn1 |
| InChI | InChI=1S/C22H18FN5O3/c1-11-4-5-12(18-19(29)22(2,3)31-28-18)8-14(11)15-9-27-16(10-26-15)17-13(21(24)30)6-7-25-20(17)23/h4-10H,1-3H3,(H2,24,30) |
| InChIKey | AVZKKWIXJFYYKR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|