C19H28N4O4 — CID 172686231
1-butylpyrrolidine;cyanocyanamide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 172686231) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-butylpyrrolidine;cyanocyanamide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-butylpyrrolidine;cyanocyanamide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 172686231 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 1-butylpyrrolidine;cyanocyanamide;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCN1CCCC1.N#CNC#N |
| InChI | InChI=1S/C9H10O4.C8H17N.C2HN3/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-3-6-9-7-4-5-8-9;3-1-5-2-4/h2-4H,5H2,1H3,(H,10,11)(H,12,13);2-8H2,1H3;5H |
| InChIKey | BBNUYQAYBNLFTB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|