About 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine
1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 172686661) has the molecular formula C18H14F2N6
and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine |
| PubChem CID | 172686661 |
| Molecular Formula | C18H14F2N6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | Nc1cc(F)c(Cn2ncc3c(-c4ccccc4)nc(N)nc32)c(F)c1 |
| InChI | InChI=1S/C18H14F2N6/c19-14-6-11(21)7-15(20)13(14)9-26-17-12(8-23-26)16(24-18(22)25-17)10-4-2-1-3-5-10/h1-8H,9,21H2,(H2,22,24,25) |
| InChIKey | BCXKVIJDOJGSEN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
The IUPAC name of 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine (CID 172686661) is 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine.
What is the SMILES notation for 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
The canonical SMILES for 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine is Nc1cc(F)c(Cn2ncc3c(-c4ccccc4)nc(N)nc32)c(F)c1.
What is the InChIKey of 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
The InChIKey is BCXKVIJDOJGSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N6/c19-14-6-11(21)7-15(20)13(14)9-26-17-12(8-23-26)16(24-18(22)25-17)10-4-2-1-3-5-10/h1-8H,9,21H2,(H2,22,24,25).
What are the key properties of 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine has a molecular weight of 352.35 g/mol, XLogP of 2.98, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-2,6-difluorophenyl)methyl]-4-phenylpyrazolo[3,4-d]pyrimidin-6-amine is sourced from PubChem (CID 172686661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).