About 1,2-dimethyl-2H-indeno[2,1-b]thiophene
1,2-dimethyl-2H-indeno[2,1-b]thiophene (PubChem CID 172686676) has the molecular formula C13H12S
and a molecular weight of 200.31 g/mol. Its IUPAC name is 1,2-dimethyl-2H-indeno[2,1-b]thiophene.
Molecular Properties
| Compound Name | 1,2-dimethyl-2H-indeno[2,1-b]thiophene |
| PubChem CID | 172686676 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1,2-dimethyl-2H-indeno[2,1-b]thiophene |
| SMILES | CC1=C2C(=Cc3ccccc32)SC1C |
| InChI | InChI=1S/C13H12S/c1-8-9(2)14-12-7-10-5-3-4-6-11(10)13(8)12/h3-7,9H,1-2H3 |
| InChIKey | BCYWPQRHQSISFA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dimethyl-2H-indeno[2,1-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-2H-indeno[2,1-b]thiophene?
The IUPAC name of 1,2-dimethyl-2H-indeno[2,1-b]thiophene (CID 172686676) is 1,2-dimethyl-2H-indeno[2,1-b]thiophene.
What is the SMILES notation for 1,2-dimethyl-2H-indeno[2,1-b]thiophene?
The canonical SMILES for 1,2-dimethyl-2H-indeno[2,1-b]thiophene is CC1=C2C(=Cc3ccccc32)SC1C.
What is the InChIKey of 1,2-dimethyl-2H-indeno[2,1-b]thiophene?
The InChIKey is BCYWPQRHQSISFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12S/c1-8-9(2)14-12-7-10-5-3-4-6-11(10)13(8)12/h3-7,9H,1-2H3.
What are the key properties of 1,2-dimethyl-2H-indeno[2,1-b]thiophene?
1,2-dimethyl-2H-indeno[2,1-b]thiophene has a molecular weight of 200.31 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-2H-indeno[2,1-b]thiophene is sourced from PubChem (CID 172686676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).