About N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide
N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide (PubChem CID 172687246) has the molecular formula C26H25F2N5O
and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide.
Molecular Properties
| Compound Name | N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide |
| PubChem CID | 172687246 |
| Molecular Formula | C26H25F2N5O |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccccc2C(=O)Nn2ncc3cc(Cc4cc(F)cc(F)c4)ccc32)CC1 |
| InChI | InChI=1S/C26H25F2N5O/c1-31-8-10-32(11-9-31)25-5-3-2-4-23(25)26(34)30-33-24-7-6-18(13-20(24)17-29-33)12-19-14-21(27)16-22(28)15-19/h2-7,13-17H,8-12H2,1H3,(H,30,34) |
| InChIKey | BEXKYFMGEMXSPQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide?
The IUPAC name of N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide (CID 172687246) is N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide.
What is the SMILES notation for N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide?
The canonical SMILES for N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide is CN1CCN(c2ccccc2C(=O)Nn2ncc3cc(Cc4cc(F)cc(F)c4)ccc32)CC1.
What is the InChIKey of N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide?
The InChIKey is BEXKYFMGEMXSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25F2N5O/c1-31-8-10-32(11-9-31)25-5-3-2-4-23(25)26(34)30-33-24-7-6-18(13-20(24)17-29-33)12-19-14-21(27)16-22(28)15-19/h2-7,13-17H,8-12H2,1H3,(H,30,34).
What are the key properties of N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide?
N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide has a molecular weight of 461.52 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-2-(4-methylpiperazin-1-yl)benzamide is sourced from PubChem (CID 172687246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).