About 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine
9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine (PubChem CID 172687749) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine.
Analyze 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine?
The IUPAC name of 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine (CID 172687749) is 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine.
What is the SMILES notation for 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine?
The canonical SMILES for 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine is CN1CCCN2C=CCN=C12.
What is the InChIKey of 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine?
The InChIKey is BGKUSPNZIKQFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-10-5-3-7-11-6-2-4-9-8(10)11/h2,6H,3-5,7H2,1H3.
What are the key properties of 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine?
9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine has a molecular weight of 151.21 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-2,6,7,8-tetrahydropyrimido[1,2-a]pyrimidine is sourced from PubChem (CID 172687749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).