C20H15N3O3S — CID 172688327
2-[[1-(1,3-thiazol-4-ylmethyl)indole-3-carbonyl]amino]benzoic acid (PubChem CID 172688327) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is 2-[[1-(1,3-thiazol-4-ylmethyl)indole-3-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[1-(1,3-thiazol-4-ylmethyl)indole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 172688327 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[[1-(1,3-thiazol-4-ylmethyl)indole-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)c1cn(Cc2cscn2)c2ccccc12 |
| InChI | InChI=1S/C20H15N3O3S/c24-19(22-17-7-3-1-6-15(17)20(25)26)16-10-23(9-13-11-27-12-21-13)18-8-4-2-5-14(16)18/h1-8,10-12H,9H2,(H,22,24)(H,25,26) |
| InChIKey | BIJUPWHHRFXIBI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |