C25H23ClO4S — CID 172688514
4-[[4-(4-chlorophenoxy)phenyl]sulfanylmethyl]-2-phenyloxane-4-carboxylic acid (PubChem CID 172688514) has the molecular formula C25H23ClO4S and a molecular weight of 454.98 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenoxy)phenyl]sulfanylmethyl]-2-phenyloxane-4-carboxylic acid.
| Compound Name | 4-[[4-(4-chlorophenoxy)phenyl]sulfanylmethyl]-2-phenyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 172688514 |
| Molecular Formula | C25H23ClO4S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 4-[[4-(4-chlorophenoxy)phenyl]sulfanylmethyl]-2-phenyloxane-4-carboxylic acid |
| SMILES | O=C(O)C1(CSc2ccc(Oc3ccc(Cl)cc3)cc2)CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C25H23ClO4S/c26-19-6-8-20(9-7-19)30-21-10-12-22(13-11-21)31-17-25(24(27)28)14-15-29-23(16-25)18-4-2-1-3-5-18/h1-13,23H,14-17H2,(H,27,28) |
| InChIKey | BIYDNQMMQATPIS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |