About 1-(2,2-difluoroethyl)-1,3-diazepine
1-(2,2-difluoroethyl)-1,3-diazepine (PubChem CID 172688766) has the molecular formula C7H8F2N2
and a molecular weight of 158.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-1,3-diazepine.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-1,3-diazepine |
| PubChem CID | 172688766 |
| Molecular Formula | C7H8F2N2 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-1,3-diazepine |
| SMILES | FC(F)CN1C=CC=CN=C1 |
| InChI | InChI=1S/C7H8F2N2/c8-7(9)5-11-4-2-1-3-10-6-11/h1-4,6-7H,5H2 |
| InChIKey | BJSUXDKVGWZOMN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethyl)-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-1,3-diazepine?
The IUPAC name of 1-(2,2-difluoroethyl)-1,3-diazepine (CID 172688766) is 1-(2,2-difluoroethyl)-1,3-diazepine.
What is the SMILES notation for 1-(2,2-difluoroethyl)-1,3-diazepine?
The canonical SMILES for 1-(2,2-difluoroethyl)-1,3-diazepine is FC(F)CN1C=CC=CN=C1.
What is the InChIKey of 1-(2,2-difluoroethyl)-1,3-diazepine?
The InChIKey is BJSUXDKVGWZOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2/c8-7(9)5-11-4-2-1-3-10-6-11/h1-4,6-7H,5H2.
What are the key properties of 1-(2,2-difluoroethyl)-1,3-diazepine?
1-(2,2-difluoroethyl)-1,3-diazepine has a molecular weight of 158.15 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-1,3-diazepine is sourced from PubChem (CID 172688766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).