About trihydroxy-(2,3,4-triethylphenyl)phosphanium
trihydroxy-(2,3,4-triethylphenyl)phosphanium (PubChem CID 172689014) has the molecular formula C12H20O3P+
and a molecular weight of 243.26 g/mol. Its IUPAC name is trihydroxy-(2,3,4-triethylphenyl)phosphanium.
Molecular Properties
| Compound Name | trihydroxy-(2,3,4-triethylphenyl)phosphanium |
| PubChem CID | 172689014 |
| Molecular Formula | C12H20O3P+ |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | trihydroxy-(2,3,4-triethylphenyl)phosphanium |
| SMILES | CCc1ccc([P+](O)(O)O)c(CC)c1CC |
| InChI | InChI=1S/C12H20O3P/c1-4-9-7-8-12(16(13,14)15)11(6-3)10(9)5-2/h7-8,13-15H,4-6H2,1-3H3/q+1 |
| InChIKey | HPCLPYKHVLNNER-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trihydroxy-(2,3,4-triethylphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihydroxy-(2,3,4-triethylphenyl)phosphanium?
The IUPAC name of trihydroxy-(2,3,4-triethylphenyl)phosphanium (CID 172689014) is trihydroxy-(2,3,4-triethylphenyl)phosphanium.
What is the SMILES notation for trihydroxy-(2,3,4-triethylphenyl)phosphanium?
The canonical SMILES for trihydroxy-(2,3,4-triethylphenyl)phosphanium is CCc1ccc([P+](O)(O)O)c(CC)c1CC.
What is the InChIKey of trihydroxy-(2,3,4-triethylphenyl)phosphanium?
The InChIKey is HPCLPYKHVLNNER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3P/c1-4-9-7-8-12(16(13,14)15)11(6-3)10(9)5-2/h7-8,13-15H,4-6H2,1-3H3/q+1.
What are the key properties of trihydroxy-(2,3,4-triethylphenyl)phosphanium?
trihydroxy-(2,3,4-triethylphenyl)phosphanium has a molecular weight of 243.26 g/mol, XLogP of 1.74, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trihydroxy-(2,3,4-triethylphenyl)phosphanium is sourced from PubChem (CID 172689014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).