C26H32N4O3 — CID 172689518
2-amino-N-(4-hydroxycyclohexyl)-5-[4-[3-(3-methyloxiran-2-yl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pyridine-3-carboxamide (PubChem CID 172689518) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-amino-N-(4-hydroxycyclohexyl)-5-[4-[3-(3-methyloxiran-2-yl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-(4-hydroxycyclohexyl)-5-[4-[3-(3-methyloxiran-2-yl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172689518 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-amino-N-(4-hydroxycyclohexyl)-5-[4-[3-(3-methyloxiran-2-yl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pyridine-3-carboxamide |
| SMILES | CC1OC1N1CC2CC2(c2ccc(-c3cnc(N)c(C(=O)NC4CCC(O)CC4)c3)cc2)C1 |
| InChI | InChI=1S/C26H32N4O3/c1-15-25(33-15)30-13-19-11-26(19,14-30)18-4-2-16(3-5-18)17-10-22(23(27)28-12-17)24(32)29-20-6-8-21(31)9-7-20/h2-5,10,12,15,19-21,25,31H,6-9,11,13-14H2,1H3,(H2,27,28)(H,29,32) |
| InChIKey | BMGWDQVPTJTGJX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|