C39H56O2 — CID 172690143
4-[(4E,6E,8E,10E,12E,14E,16E)-17-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 172690143) has the molecular formula C39H56O2 and a molecular weight of 556.88 g/mol. Its IUPAC name is 4-[(4E,6E,8E,10E,12E,14E,16E)-17-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | 4-[(4E,6E,8E,10E,12E,14E,16E)-17-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 172690143 |
| Molecular Formula | C39H56O2 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | 4-[(4E,6E,8E,10E,12E,14E,16E)-17-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC(=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CC(O)CC1(C)C)CC1=C(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C39H56O2/c1-28(17-13-19-30(3)21-22-36-32(5)24-34(40)26-38(36,7)8)15-11-12-16-29(2)18-14-20-31(4)23-37-33(6)25-35(41)27-39(37,9)10/h11-22,34-35,40-41H,23-27H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,28-15+,29-16+,30-19+,31-20? |
| InChIKey | BOMMYOXQLFDQOE-JBGDUXDTSA-N |
| XLogP | 10.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|