C23H40FN — CID 172690307
(5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methylicosa-5,8,11,14-tetraen-1-amine (PubChem CID 172690307) has the molecular formula C23H40FN and a molecular weight of 349.58 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methylicosa-5,8,11,14-tetraen-1-amine.
| Compound Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methylicosa-5,8,11,14-tetraen-1-amine |
|---|---|
| PubChem CID | 172690307 |
| Molecular Formula | C23H40FN |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-fluoroethyl)-2-methylicosa-5,8,11,14-tetraen-1-amine |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(C)CNCCF |
| InChI | InChI=1S/C23H40FN/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(2)22-25-21-20-24/h7-8,10-11,13-14,16-17,23,25H,3-6,9,12,15,18-22H2,1-2H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | BOXFRQUVAYQDOL-ZKWNWVNESA-N |
| XLogP | 6.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|