C30H29Cl2F3N4O3 — CID 172692495
4-amino-2-fluorobenzamide;(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid (PubChem CID 172692495) has the molecular formula C30H29Cl2F3N4O3 and a molecular weight of 621.49 g/mol. Its IUPAC name is 4-amino-2-fluorobenzamide;(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-amino-2-fluorobenzamide;(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 172692495 |
| Molecular Formula | C30H29Cl2F3N4O3 |
| Molecular Weight | 621.49 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 4-amino-2-fluorobenzamide;(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)O)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F.NC(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C23H22Cl2F2N2O2.C7H7FN2O/c1-22(2,3)10-17-23(11-28,14-8-7-12(24)9-16(14)26)18(20(29-17)21(30)31)13-5-4-6-15(25)19(13)27;8-6-3-4(9)1-2-5(6)7(10)11/h4-9,17-18,20,29H,10H2,1-3H3,(H,30,31);1-3H,9H2,(H2,10,11)/t17-,18-,20+,23-;/m0./s1 |
| InChIKey | BWFQRIJZNRYEOB-PYWYQZOKSA-N |
| XLogP | 6.18 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|