About 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid
5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 172692552) has the molecular formula C9H7F3N2O2S2
and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| PubChem CID | 172692552 |
| Molecular Formula | C9H7F3N2O2S2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| SMILES | CCSc1cnc2sc(C(=O)O)c(C(F)(F)F)n12 |
| InChI | InChI=1S/C9H7F3N2O2S2/c1-2-17-4-3-13-8-14(4)6(9(10,11)12)5(18-8)7(15)16/h3H,2H2,1H3,(H,15,16) |
| InChIKey | BWMOQJNROOSQIU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
The IUPAC name of 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid (CID 172692552) is 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
What is the SMILES notation for 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
The canonical SMILES for 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is CCSc1cnc2sc(C(=O)O)c(C(F)(F)F)n12.
What is the InChIKey of 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
The InChIKey is BWMOQJNROOSQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2O2S2/c1-2-17-4-3-13-8-14(4)6(9(10,11)12)5(18-8)7(15)16/h3H,2H2,1H3,(H,15,16).
What are the key properties of 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid?
5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid has a molecular weight of 296.30 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyl-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid is sourced from PubChem (CID 172692552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).