About [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate
[1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate (PubChem CID 172693027) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate.
Molecular Properties
| Compound Name | [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate |
| PubChem CID | 172693027 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate |
| SMILES | CCC1=CC[C@H]2CC(=CC(C)(C)OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C15H22O2/c1-5-11-6-7-12-8-13(14(11)12)9-15(3,4)17-10(2)16/h6,9,12,14H,5,7-8H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | BYAWTYWWJCREIF-JSGCOSHPSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate?
The IUPAC name of [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate (CID 172693027) is [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate.
What is the SMILES notation for [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate?
The canonical SMILES for [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate is CCC1=CC[C@H]2CC(=CC(C)(C)OC(C)=O)[C@@H]12.
What is the InChIKey of [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate?
The InChIKey is BYAWTYWWJCREIF-JSGCOSHPSA-N. The full InChI is InChI=1S/C15H22O2/c1-5-11-6-7-12-8-13(14(11)12)9-15(3,4)17-10(2)16/h6,9,12,14H,5,7-8H2,1-4H3/t12-,14-/m0/s1.
What are the key properties of [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate?
[1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate has a molecular weight of 234.34 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1S,5R)-4-ethyl-6-bicyclo[3.2.0]hept-3-enylidene]-2-methylpropan-2-yl] acetate is sourced from PubChem (CID 172693027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).