C9H16N2 — CID 172693783
N,N,2,2-tetramethyl-3H-pyridin-4-amine (PubChem CID 172693783) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-3H-pyridin-4-amine.
| Compound Name | N,N,2,2-tetramethyl-3H-pyridin-4-amine |
|---|---|
| PubChem CID | 172693783 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N,N,2,2-tetramethyl-3H-pyridin-4-amine |
| SMILES | CN(C)C1=CC=NC(C)(C)C1 |
| InChI | InChI=1S/C9H16N2/c1-9(2)7-8(11(3)4)5-6-10-9/h5-6H,7H2,1-4H3 |
| InChIKey | CARPUNADYIRICL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |