C17H19NO4S — CID 172693883
5-[[2-(cyclopropylmethoxymethylsulfonyl)phenyl]methyl]-1H-pyridin-2-one (PubChem CID 172693883) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-[[2-(cyclopropylmethoxymethylsulfonyl)phenyl]methyl]-1H-pyridin-2-one.
| Compound Name | 5-[[2-(cyclopropylmethoxymethylsulfonyl)phenyl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 172693883 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 5-[[2-(cyclopropylmethoxymethylsulfonyl)phenyl]methyl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(Cc2ccccc2S(=O)(=O)COCC2CC2)c[nH]1 |
| InChI | InChI=1S/C17H19NO4S/c19-17-8-7-14(10-18-17)9-15-3-1-2-4-16(15)23(20,21)12-22-11-13-5-6-13/h1-4,7-8,10,13H,5-6,9,11-12H2,(H,18,19) |
| InChIKey | CBBRCHPSMIZKDX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |