About diethoxy(methyl)silane;isocyanic acid
diethoxy(methyl)silane;isocyanic acid (PubChem CID 172694578) has the molecular formula C6H15NO3Si
and a molecular weight of 177.28 g/mol. Its IUPAC name is diethoxy(methyl)silane;isocyanic acid.
Molecular Properties
| Compound Name | diethoxy(methyl)silane;isocyanic acid |
| PubChem CID | 172694578 |
| Molecular Formula | C6H15NO3Si |
| Molecular Weight | 177.28 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | diethoxy(methyl)silane;isocyanic acid |
| SMILES | CCO[SiH](C)OCC.N=C=O |
| InChI | InChI=1S/C5H14O2Si.CHNO/c1-4-6-8(3)7-5-2;2-1-3/h8H,4-5H2,1-3H3;2H |
| InChIKey | CDNMPXXVVMDCNJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(methyl)silane;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(methyl)silane;isocyanic acid?
The IUPAC name of diethoxy(methyl)silane;isocyanic acid (CID 172694578) is diethoxy(methyl)silane;isocyanic acid.
What is the SMILES notation for diethoxy(methyl)silane;isocyanic acid?
The canonical SMILES for diethoxy(methyl)silane;isocyanic acid is CCO[SiH](C)OCC.N=C=O.
What is the InChIKey of diethoxy(methyl)silane;isocyanic acid?
The InChIKey is CDNMPXXVVMDCNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O2Si.CHNO/c1-4-6-8(3)7-5-2;2-1-3/h8H,4-5H2,1-3H3;2H.
What are the key properties of diethoxy(methyl)silane;isocyanic acid?
diethoxy(methyl)silane;isocyanic acid has a molecular weight of 177.28 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(methyl)silane;isocyanic acid is sourced from PubChem (CID 172694578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).