About phenylmethanol;triphenylphosphane
phenylmethanol;triphenylphosphane (PubChem CID 172697327) has the molecular formula C25H23OP
and a molecular weight of 370.43 g/mol. Its IUPAC name is phenylmethanol;triphenylphosphane.
Molecular Properties
| Compound Name | phenylmethanol;triphenylphosphane |
| PubChem CID | 172697327 |
| Molecular Formula | C25H23OP |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | phenylmethanol;triphenylphosphane |
| SMILES | OCc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C7H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;1-5,8H,6H2 |
| InChIKey | CMLKPELIICHSQX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanol;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanol;triphenylphosphane?
The IUPAC name of phenylmethanol;triphenylphosphane (CID 172697327) is phenylmethanol;triphenylphosphane.
What is the SMILES notation for phenylmethanol;triphenylphosphane?
The canonical SMILES for phenylmethanol;triphenylphosphane is OCc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of phenylmethanol;triphenylphosphane?
The InChIKey is CMLKPELIICHSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C7H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6-7-4-2-1-3-5-7/h1-15H;1-5,8H,6H2.
What are the key properties of phenylmethanol;triphenylphosphane?
phenylmethanol;triphenylphosphane has a molecular weight of 370.43 g/mol, XLogP of 4.62, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanol;triphenylphosphane is sourced from PubChem (CID 172697327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).