C12H18F2N2 — CID 172698488
4-(4,4-difluorocyclohexyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 172698488) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(4,4-difluorocyclohexyl)cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-(4,4-difluorocyclohexyl)cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 172698488 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-(4,4-difluorocyclohexyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(C2CCC(F)(F)CC2)C=C1 |
| InChI | InChI=1S/C12H18F2N2/c13-12(14)7-1-9(2-8-12)11(16)5-3-10(15)4-6-11/h3-5,9H,1-2,6-8,15-16H2 |
| InChIKey | CQHXGRVQARMXQE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |