C7H8F9N3S — CID 172699335
1-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)thiourea (PubChem CID 172699335) has the molecular formula C7H8F9N3S and a molecular weight of 337.21 g/mol. Its IUPAC name is 1-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)thiourea.
| Compound Name | 1-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)thiourea |
|---|---|
| PubChem CID | 172699335 |
| Molecular Formula | C7H8F9N3S |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 1-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylamino)thiourea |
| SMILES | CNC(=S)NNCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F9N3S/c1-17-3(20)19-18-2-4(8,9)5(10,11)6(12,13)7(14,15)16/h18H,2H2,1H3,(H2,17,19,20) |
| InChIKey | CTDOGIOJIKVPNU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|