C19H18O3 — CID 172699559
9-(2-methylphenoxy)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione (PubChem CID 172699559) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 9-(2-methylphenoxy)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione.
| Compound Name | 9-(2-methylphenoxy)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione |
|---|---|
| PubChem CID | 172699559 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 9-(2-methylphenoxy)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-11,12-dione |
| SMILES | Cc1ccccc1OC1CC2C(=O)C1C1C3C=CC(C3=O)C21 |
| InChI | InChI=1S/C19H18O3/c1-9-4-2-3-5-13(9)22-14-8-12-15-10-6-7-11(18(10)20)16(15)17(14)19(12)21/h2-7,10-12,14-17H,8H2,1H3 |
| InChIKey | CTXPSTMCLQQRPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|