C39H41N5O — CID 172700250
(5S)-2-[3-[[3-(1-methylpiperidin-2-yl)phenyl]-diphenylmethyl]indazol-1-yl]-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 172700250) has the molecular formula C39H41N5O and a molecular weight of 595.79 g/mol. Its IUPAC name is (5S)-2-[3-[[3-(1-methylpiperidin-2-yl)phenyl]-diphenylmethyl]indazol-1-yl]-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S)-2-[3-[[3-(1-methylpiperidin-2-yl)phenyl]-diphenylmethyl]indazol-1-yl]-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 172700250 |
| Molecular Formula | C39H41N5O |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | (5S)-2-[3-[[3-(1-methylpiperidin-2-yl)phenyl]-diphenylmethyl]indazol-1-yl]-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | CN1CCCCC1c1cccc(C(c2ccccc2)(c2ccccc2)c2nn(N3CC[C@]4(CCNC4)C3=O)c3ccccc23)c1 |
| InChI | InChI=1S/C39H41N5O/c1-42-25-11-10-20-34(42)29-13-12-18-32(27-29)39(30-14-4-2-5-15-30,31-16-6-3-7-17-31)36-33-19-8-9-21-35(33)44(41-36)43-26-23-38(37(43)45)22-24-40-28-38/h2-9,12-19,21,27,34,40H,10-11,20,22-26,28H2,1H3/t34?,38-/m0/s1 |
| InChIKey | CWDZIVKFXKTIIG-GJZOKPFYSA-N |
| XLogP | 6.42 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|