C14H14ClFN2O2 — CID 172700440
2-(chloromethyl)-3-[[1-(fluoromethyl)cyclopropyl]methyl]benzimidazole-5-carboxylic acid (PubChem CID 172700440) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[[1-(fluoromethyl)cyclopropyl]methyl]benzimidazole-5-carboxylic acid.
| Compound Name | 2-(chloromethyl)-3-[[1-(fluoromethyl)cyclopropyl]methyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 172700440 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(chloromethyl)-3-[[1-(fluoromethyl)cyclopropyl]methyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(CCl)n(CC3(CF)CC3)c2c1 |
| InChI | InChI=1S/C14H14ClFN2O2/c15-6-12-17-10-2-1-9(13(19)20)5-11(10)18(12)8-14(7-16)3-4-14/h1-2,5H,3-4,6-8H2,(H,19,20) |
| InChIKey | CWTXWMPVRBZLKY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|