C10H19F3N2 — CID 172700841
(7S)-1-propyl-7-(2,2,2-trifluoroethyl)-1,4-diazepane (PubChem CID 172700841) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is (7S)-1-propyl-7-(2,2,2-trifluoroethyl)-1,4-diazepane.
| Compound Name | (7S)-1-propyl-7-(2,2,2-trifluoroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 172700841 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (7S)-1-propyl-7-(2,2,2-trifluoroethyl)-1,4-diazepane |
| SMILES | CCCN1CCNCC[C@H]1CC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2/c1-2-6-15-7-5-14-4-3-9(15)8-10(11,12)13/h9,14H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | CYCVGUBQRSWHRU-VIFPVBQESA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |