About 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide
11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide (PubChem CID 172701636) has the molecular formula C18H13O4PS
and a molecular weight of 356.34 g/mol. Its IUPAC name is 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide.
Molecular Properties
| Compound Name | 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide |
| PubChem CID | 172701636 |
| Molecular Formula | C18H13O4PS |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide |
| SMILES | O=P1(Oc2ccccc2)Oc2ccccc2Sc2ccccc2O1 |
| InChI | InChI=1S/C18H13O4PS/c19-23(20-14-8-2-1-3-9-14)21-15-10-4-6-12-17(15)24-18-13-7-5-11-16(18)22-23/h1-13H |
| InChIKey | DASOVCFAHCIRTE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide?
The IUPAC name of 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide (CID 172701636) is 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide.
What is the SMILES notation for 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide?
The canonical SMILES for 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide is O=P1(Oc2ccccc2)Oc2ccccc2Sc2ccccc2O1.
What is the InChIKey of 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide?
The InChIKey is DASOVCFAHCIRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13O4PS/c19-23(20-14-8-2-1-3-9-14)21-15-10-4-6-12-17(15)24-18-13-7-5-11-16(18)22-23/h1-13H.
What are the key properties of 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide?
11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide has a molecular weight of 356.34 g/mol, XLogP of 5.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-phenoxybenzo[d][1,3,6,2]benzodioxathiaphosphocine 11-oxide is sourced from PubChem (CID 172701636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).