About dimethoxy(methyl)silane;dihydrochloride
dimethoxy(methyl)silane;dihydrochloride (PubChem CID 172701721) has the molecular formula C3H12Cl2O2Si
and a molecular weight of 179.12 g/mol. Its IUPAC name is dimethoxy(methyl)silane;dihydrochloride.
Molecular Properties
| Compound Name | dimethoxy(methyl)silane;dihydrochloride |
| PubChem CID | 172701721 |
| Molecular Formula | C3H12Cl2O2Si |
| Molecular Weight | 179.12 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | dimethoxy(methyl)silane;dihydrochloride |
| SMILES | CO[SiH](C)OC.Cl.Cl |
| InChI | InChI=1S/C3H10O2Si.2ClH/c1-4-6(3)5-2;;/h6H,1-3H3;2*1H |
| InChIKey | DAYRLQYFQWYKEF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.12 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(methyl)silane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(methyl)silane;dihydrochloride?
The IUPAC name of dimethoxy(methyl)silane;dihydrochloride (CID 172701721) is dimethoxy(methyl)silane;dihydrochloride.
What is the SMILES notation for dimethoxy(methyl)silane;dihydrochloride?
The canonical SMILES for dimethoxy(methyl)silane;dihydrochloride is CO[SiH](C)OC.Cl.Cl.
What is the InChIKey of dimethoxy(methyl)silane;dihydrochloride?
The InChIKey is DAYRLQYFQWYKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O2Si.2ClH/c1-4-6(3)5-2;;/h6H,1-3H3;2*1H.
What are the key properties of dimethoxy(methyl)silane;dihydrochloride?
dimethoxy(methyl)silane;dihydrochloride has a molecular weight of 179.12 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(methyl)silane;dihydrochloride is sourced from PubChem (CID 172701721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).