About cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene
cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene (PubChem CID 172702262) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene.
Molecular Properties
| Compound Name | cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene |
| PubChem CID | 172702262 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene |
| SMILES | Cc1cc(-c2ccccc2)c(C)c(C)c1C.N#CO |
| InChI | InChI=1S/C16H18.CHNO/c1-11-10-16(14(4)13(3)12(11)2)15-8-6-5-7-9-15;2-1-3/h5-10H,1-4H3;3H |
| InChIKey | DCSCTICWCJBLBK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene?
The IUPAC name of cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene (CID 172702262) is cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene.
What is the SMILES notation for cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene?
The canonical SMILES for cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene is Cc1cc(-c2ccccc2)c(C)c(C)c1C.N#CO.
What is the InChIKey of cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene?
The InChIKey is DCSCTICWCJBLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.CHNO/c1-11-10-16(14(4)13(3)12(11)2)15-8-6-5-7-9-15;2-1-3/h5-10H,1-4H3;3H.
What are the key properties of cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene?
cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene has a molecular weight of 253.34 g/mol, XLogP of 4.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;1,2,3,4-tetramethyl-5-phenylbenzene is sourced from PubChem (CID 172702262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).