C21H41NO4 — CID 172703393
[1-(2,2-dimethylpropanoyloxy)-1-(methylamino)decyl] 2,2-dimethylpropanoate (PubChem CID 172703393) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoyloxy)-1-(methylamino)decyl] 2,2-dimethylpropanoate.
| Compound Name | [1-(2,2-dimethylpropanoyloxy)-1-(methylamino)decyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 172703393 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | [1-(2,2-dimethylpropanoyloxy)-1-(methylamino)decyl] 2,2-dimethylpropanoate |
| SMILES | CCCCCCCCCC(NC)(OC(=O)C(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H41NO4/c1-9-10-11-12-13-14-15-16-21(22-8,25-17(23)19(2,3)4)26-18(24)20(5,6)7/h22H,9-16H2,1-8H3 |
| InChIKey | DGLSBBSQJZNJGH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|