C9H8F6O — CID 172704020
1-(1,1,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-ol (PubChem CID 172704020) has the molecular formula C9H8F6O and a molecular weight of 246.15 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 172704020 |
| Molecular Formula | C9H8F6O |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-ol |
| SMILES | OC1(C(F)(F)C(F)C(F)(F)F)C=CC=CC1 |
| InChI | InChI=1S/C9H8F6O/c10-6(9(13,14)15)8(11,12)7(16)4-2-1-3-5-7/h1-4,6,16H,5H2 |
| InChIKey | DILYSYPYTNFKQG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |