About oxetane-2-sulfinic acid
oxetane-2-sulfinic acid (PubChem CID 172704038) has the molecular formula C3H6O3S
and a molecular weight of 122.14 g/mol. Its IUPAC name is oxetane-2-sulfinic acid.
Molecular Properties
| Compound Name | oxetane-2-sulfinic acid |
| PubChem CID | 172704038 |
| Molecular Formula | C3H6O3S |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | oxetane-2-sulfinic acid |
| SMILES | O=S(O)C1CCO1 |
| InChI | InChI=1S/C3H6O3S/c4-7(5)3-1-2-6-3/h3H,1-2H2,(H,4,5) |
| InChIKey | JNUDNAMQAHKPPQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze oxetane-2-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetane-2-sulfinic acid?
The IUPAC name of oxetane-2-sulfinic acid (CID 172704038) is oxetane-2-sulfinic acid.
What is the SMILES notation for oxetane-2-sulfinic acid?
The canonical SMILES for oxetane-2-sulfinic acid is O=S(O)C1CCO1.
What is the InChIKey of oxetane-2-sulfinic acid?
The InChIKey is JNUDNAMQAHKPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3S/c4-7(5)3-1-2-6-3/h3H,1-2H2,(H,4,5).
What are the key properties of oxetane-2-sulfinic acid?
oxetane-2-sulfinic acid has a molecular weight of 122.14 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxetane-2-sulfinic acid is sourced from PubChem (CID 172704038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).