About 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride
1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride (PubChem CID 172704681) has the molecular formula C8H12ClF3N2O2
and a molecular weight of 260.64 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride |
| PubChem CID | 172704681 |
| Molecular Formula | C8H12ClF3N2O2 |
| Molecular Weight | 260.64 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride |
| SMILES | Cl.NC(=O)C1=CN(CC(F)(F)F)C=CC1.O |
| InChI | InChI=1S/C8H9F3N2O.ClH.H2O/c9-8(10,11)5-13-3-1-2-6(4-13)7(12)14;;/h1,3-4H,2,5H2,(H2,12,14);1H;1H2 |
| InChIKey | DKSJWASKHGIKOH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.64 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride?
The IUPAC name of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride (CID 172704681) is 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride is Cl.NC(=O)C1=CN(CC(F)(F)F)C=CC1.O.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride?
The InChIKey is DKSJWASKHGIKOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O.ClH.H2O/c9-8(10,11)5-13-3-1-2-6(4-13)7(12)14;;/h1,3-4H,2,5H2,(H2,12,14);1H;1H2.
What are the key properties of 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride?
1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride has a molecular weight of 260.64 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)-4H-pyridine-3-carboxamide;hydrate;hydrochloride is sourced from PubChem (CID 172704681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).