About 2-octoxybut-1-ene-1,3-dione
2-octoxybut-1-ene-1,3-dione (PubChem CID 172704868) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-octoxybut-1-ene-1,3-dione.
Molecular Properties
| Compound Name | 2-octoxybut-1-ene-1,3-dione |
| PubChem CID | 172704868 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-octoxybut-1-ene-1,3-dione |
| SMILES | CCCCCCCCOC(=C=O)C(C)=O |
| InChI | InChI=1S/C12H20O3/c1-3-4-5-6-7-8-9-15-12(10-13)11(2)14/h3-9H2,1-2H3 |
| InChIKey | DLHQKZXUOODNGM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxybut-1-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxybut-1-ene-1,3-dione?
The IUPAC name of 2-octoxybut-1-ene-1,3-dione (CID 172704868) is 2-octoxybut-1-ene-1,3-dione.
What is the SMILES notation for 2-octoxybut-1-ene-1,3-dione?
The canonical SMILES for 2-octoxybut-1-ene-1,3-dione is CCCCCCCCOC(=C=O)C(C)=O.
What is the InChIKey of 2-octoxybut-1-ene-1,3-dione?
The InChIKey is DLHQKZXUOODNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-3-4-5-6-7-8-9-15-12(10-13)11(2)14/h3-9H2,1-2H3.
What are the key properties of 2-octoxybut-1-ene-1,3-dione?
2-octoxybut-1-ene-1,3-dione has a molecular weight of 212.29 g/mol, XLogP of 2.67, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxybut-1-ene-1,3-dione is sourced from PubChem (CID 172704868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).